C31H36N5O4+ — CID 142929571
7-methoxy-N-[4-[(Z)-C-methyl-N-phenylmethoxycarbonimidoyl]phenyl]-6-(3-morpholin-4-ylpropoxy)quinazolin-3-ium-4-amine (PubChem CID 142929571) has the molecular formula C31H36N5O4+ and a molecular weight of 542.66 g/mol. Its IUPAC name is 7-methoxy-N-[4-[(Z)-C-methyl-N-phenylmethoxycarbonimidoyl]phenyl]-6-(3-morpholin-4-ylpropoxy)quinazolin-3-ium-4-amine.
| Compound Name | 7-methoxy-N-[4-[(Z)-C-methyl-N-phenylmethoxycarbonimidoyl]phenyl]-6-(3-morpholin-4-ylpropoxy)quinazolin-3-ium-4-amine |
|---|---|
| PubChem CID | 142929571 |
| Molecular Formula | C31H36N5O4+ |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | 7-methoxy-N-[4-[(Z)-C-methyl-N-phenylmethoxycarbonimidoyl]phenyl]-6-(3-morpholin-4-ylpropoxy)quinazolin-3-ium-4-amine |
| SMILES | COc1cc2nc[nH+]c(Nc3ccc(/C(C)=N\OCc4ccccc4)cc3)c2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C31H35N5O4/c1-23(35-40-21-24-7-4-3-5-8-24)25-9-11-26(12-10-25)34-31-27-19-30(29(37-2)20-28(27)32-22-33-31)39-16-6-13-36-14-17-38-18-15-36/h3-5,7-12,19-20,22H,6,13-18,21H2,1-2H3,(H,32,33,34)/p+1/b35-23- |
| InChIKey | CRMYHNOFETXBCD-NHYZDEDTSA-O |
| XLogP | 4.84 |
| TPSA | 91.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|