C32H37N5O3 — CID 85136523
6-methoxy-N-[4-(C-methyl-N-phenylmethoxycarbonimidoyl)phenyl]-7-(3-piperidin-1-ylpropoxy)quinazolin-4-amine (PubChem CID 85136523) has the molecular formula C32H37N5O3 and a molecular weight of 539.68 g/mol. Its IUPAC name is 6-methoxy-N-[4-(C-methyl-N-phenylmethoxycarbonimidoyl)phenyl]-7-(3-piperidin-1-ylpropoxy)quinazolin-4-amine.
| Compound Name | 6-methoxy-N-[4-(C-methyl-N-phenylmethoxycarbonimidoyl)phenyl]-7-(3-piperidin-1-ylpropoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 85136523 |
| Molecular Formula | C32H37N5O3 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.29 |
| IUPAC Name | 6-methoxy-N-[4-(C-methyl-N-phenylmethoxycarbonimidoyl)phenyl]-7-(3-piperidin-1-ylpropoxy)quinazolin-4-amine |
| SMILES | COc1cc2c(Nc3ccc(C(C)=NOCc4ccccc4)cc3)ncnc2cc1OCCCN1CCCCC1 |
| InChI | InChI=1S/C32H37N5O3/c1-24(36-40-22-25-10-5-3-6-11-25)26-12-14-27(15-13-26)35-32-28-20-30(38-2)31(21-29(28)33-23-34-32)39-19-9-18-37-16-7-4-8-17-37/h3,5-6,10-15,20-21,23H,4,7-9,16-19,22H2,1-2H3,(H,33,34,35) |
| InChIKey | CMJWLXIXHIWGNP-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|