C13H9FN4 — CID 10633767
6-fluoro-N-phenylpyrido[3,4-d]pyrimidin-4-amine (PubChem CID 10633767) has the molecular formula C13H9FN4 and a molecular weight of 240.24 g/mol. Its IUPAC name is 6-fluoro-N-phenylpyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | 6-fluoro-N-phenylpyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 10633767 |
| Molecular Formula | C13H9FN4 |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 6-fluoro-N-phenylpyrido[3,4-d]pyrimidin-4-amine |
| SMILES | Fc1cc2c(Nc3ccccc3)ncnc2cn1 |
| InChI | InChI=1S/C13H9FN4/c14-12-6-10-11(7-15-12)16-8-17-13(10)18-9-4-2-1-3-5-9/h1-8H,(H,16,17,18) |
| InChIKey | LEPLVUNJCIDPAG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|