C14H9F2N3 — CID 166377180
7,8-difluoro-N-phenylquinazolin-4-amine (PubChem CID 166377180) has the molecular formula C14H9F2N3 and a molecular weight of 257.24 g/mol. Its IUPAC name is 7,8-difluoro-N-phenylquinazolin-4-amine.
| Compound Name | 7,8-difluoro-N-phenylquinazolin-4-amine |
|---|---|
| PubChem CID | 166377180 |
| Molecular Formula | C14H9F2N3 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 7,8-difluoro-N-phenylquinazolin-4-amine |
| SMILES | Fc1ccc2c(Nc3ccccc3)ncnc2c1F |
| InChI | InChI=1S/C14H9F2N3/c15-11-7-6-10-13(12(11)16)17-8-18-14(10)19-9-4-2-1-3-5-9/h1-8H,(H,17,18,19) |
| InChIKey | VHMONAGDFOYFIE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |