C16H14FN3O — CID 119045645
8-fluoro-N-[3-(methoxymethyl)phenyl]quinazolin-4-amine (PubChem CID 119045645) has the molecular formula C16H14FN3O and a molecular weight of 283.31 g/mol. Its IUPAC name is 8-fluoro-N-[3-(methoxymethyl)phenyl]quinazolin-4-amine.
| Compound Name | 8-fluoro-N-[3-(methoxymethyl)phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 119045645 |
| Molecular Formula | C16H14FN3O |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 8-fluoro-N-[3-(methoxymethyl)phenyl]quinazolin-4-amine |
| SMILES | COCc1cccc(Nc2ncnc3c(F)cccc23)c1 |
| InChI | InChI=1S/C16H14FN3O/c1-21-9-11-4-2-5-12(8-11)20-16-13-6-3-7-14(17)15(13)18-10-19-16/h2-8,10H,9H2,1H3,(H,18,19,20) |
| InChIKey | NRDIFWLZAYZBNN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |