C14H8F3N3 — CID 110434738
N-(2,4-difluorophenyl)-8-fluoroquinazolin-4-amine (PubChem CID 110434738) has the molecular formula C14H8F3N3 and a molecular weight of 275.23 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-8-fluoroquinazolin-4-amine.
| Compound Name | N-(2,4-difluorophenyl)-8-fluoroquinazolin-4-amine |
|---|---|
| PubChem CID | 110434738 |
| Molecular Formula | C14H8F3N3 |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | N-(2,4-difluorophenyl)-8-fluoroquinazolin-4-amine |
| SMILES | Fc1ccc(Nc2ncnc3c(F)cccc23)c(F)c1 |
| InChI | InChI=1S/C14H8F3N3/c15-8-4-5-12(11(17)6-8)20-14-9-2-1-3-10(16)13(9)18-7-19-14/h1-7H,(H,18,19,20) |
| InChIKey | YJBFQJZNFLEMRF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |