C19H25N3 — CID 169425535
6,7-dimethyl-N-phenylquinazolin-4-amine;ethane;methane (PubChem CID 169425535) has the molecular formula C19H25N3 and a molecular weight of 295.43 g/mol. Its IUPAC name is 6,7-dimethyl-N-phenylquinazolin-4-amine;ethane;methane.
| Compound Name | 6,7-dimethyl-N-phenylquinazolin-4-amine;ethane;methane |
|---|---|
| PubChem CID | 169425535 |
| Molecular Formula | C19H25N3 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | 6,7-dimethyl-N-phenylquinazolin-4-amine;ethane;methane |
| SMILES | C.CC.Cc1cc2ncnc(Nc3ccccc3)c2cc1C |
| InChI | InChI=1S/C16H15N3.C2H6.CH4/c1-11-8-14-15(9-12(11)2)17-10-18-16(14)19-13-6-4-3-5-7-13;1-2;/h3-10H,1-2H3,(H,17,18,19);1-2H3;1H4 |
| InChIKey | GUOFXCZSCCQUIL-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |