C17H20N4 — CID 90952927
6,7-dimethyl-N-phenylpyrido[2,3-d]pyrimidin-4-amine;ethane (PubChem CID 90952927) has the molecular formula C17H20N4 and a molecular weight of 280.38 g/mol. Its IUPAC name is 6,7-dimethyl-N-phenylpyrido[2,3-d]pyrimidin-4-amine;ethane.
| Compound Name | 6,7-dimethyl-N-phenylpyrido[2,3-d]pyrimidin-4-amine;ethane |
|---|---|
| PubChem CID | 90952927 |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 6,7-dimethyl-N-phenylpyrido[2,3-d]pyrimidin-4-amine;ethane |
| SMILES | CC.Cc1cc2c(Nc3ccccc3)ncnc2nc1C |
| InChI | InChI=1S/C15H14N4.C2H6/c1-10-8-13-14(18-11(10)2)16-9-17-15(13)19-12-6-4-3-5-7-12;1-2/h3-9H,1-2H3,(H,16,17,18,19);1-2H3 |
| InChIKey | IXZHHYCCOMNEDR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |