C19H15N3O — CID 11681004
6-(4-methylphenyl)-N-phenylfuro[2,3-d]pyrimidin-4-amine (PubChem CID 11681004) has the molecular formula C19H15N3O and a molecular weight of 301.35 g/mol. Its IUPAC name is 6-(4-methylphenyl)-N-phenylfuro[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-(4-methylphenyl)-N-phenylfuro[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 11681004 |
| Molecular Formula | C19H15N3O |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 6-(4-methylphenyl)-N-phenylfuro[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1ccc(-c2cc3c(Nc4ccccc4)ncnc3o2)cc1 |
| InChI | InChI=1S/C19H15N3O/c1-13-7-9-14(10-8-13)17-11-16-18(20-12-21-19(16)23-17)22-15-5-3-2-4-6-15/h2-12H,1H3,(H,20,21,22) |
| InChIKey | RVGQCAMSBCQLCS-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |