C19H16N4O — CID 3234707
6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-phenylquinazolin-4-amine (PubChem CID 3234707) has the molecular formula C19H16N4O and a molecular weight of 316.36 g/mol. Its IUPAC name is 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-phenylquinazolin-4-amine.
| Compound Name | 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-phenylquinazolin-4-amine |
|---|---|
| PubChem CID | 3234707 |
| Molecular Formula | C19H16N4O |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-phenylquinazolin-4-amine |
| SMILES | Cc1noc(C)c1-c1ccc2ncnc(Nc3ccccc3)c2c1 |
| InChI | InChI=1S/C19H16N4O/c1-12-18(13(2)24-23-12)14-8-9-17-16(10-14)19(21-11-20-17)22-15-6-4-3-5-7-15/h3-11H,1-2H3,(H,20,21,22) |
| InChIKey | NNUPKVVHXZMMGM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |