C13H11N3O2 — CID 135755223
6-(3,5-dimethyl-1,2-oxazol-4-yl)-3H-quinazolin-4-one (PubChem CID 135755223) has the molecular formula C13H11N3O2 and a molecular weight of 241.25 g/mol. Its IUPAC name is 6-(3,5-dimethyl-1,2-oxazol-4-yl)-3H-quinazolin-4-one.
| Compound Name | 6-(3,5-dimethyl-1,2-oxazol-4-yl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135755223 |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 6-(3,5-dimethyl-1,2-oxazol-4-yl)-3H-quinazolin-4-one |
| SMILES | Cc1noc(C)c1-c1ccc2nc[nH]c(=O)c2c1 |
| InChI | InChI=1S/C13H11N3O2/c1-7-12(8(2)18-16-7)9-3-4-11-10(5-9)13(17)15-6-14-11/h3-6H,1-2H3,(H,14,15,17) |
| InChIKey | ANSYSZBOLPCYII-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |