C14H19NO — CID 142046789
3,5-dimethyl-4-(4-methylphenyl)-1,2-oxazole;ethane (PubChem CID 142046789) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 3,5-dimethyl-4-(4-methylphenyl)-1,2-oxazole;ethane.
| Compound Name | 3,5-dimethyl-4-(4-methylphenyl)-1,2-oxazole;ethane |
|---|---|
| PubChem CID | 142046789 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 3,5-dimethyl-4-(4-methylphenyl)-1,2-oxazole;ethane |
| SMILES | CC.Cc1ccc(-c2c(C)noc2C)cc1 |
| InChI | InChI=1S/C12H13NO.C2H6/c1-8-4-6-11(7-5-8)12-9(2)13-14-10(12)3;1-2/h4-7H,1-3H3;1-2H3 |
| InChIKey | WEZXVFHLKXSXDW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |