C13H17N3O3S — CID 110669886
4-[4-(dimethylsulfamoylamino)phenyl]-3,5-dimethyl-1,2-oxazole (PubChem CID 110669886) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is 4-[4-(dimethylsulfamoylamino)phenyl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[4-(dimethylsulfamoylamino)phenyl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 110669886 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 4-[4-(dimethylsulfamoylamino)phenyl]-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1-c1ccc(NS(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C13H17N3O3S/c1-9-13(10(2)19-14-9)11-5-7-12(8-6-11)15-20(17,18)16(3)4/h5-8,15H,1-4H3 |
| InChIKey | NQNUGNKGQYDCFT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |