C15H10N2O3 — CID 135858724
6-(1,3-benzodioxol-5-yl)-3H-quinazolin-4-one (PubChem CID 135858724) has the molecular formula C15H10N2O3 and a molecular weight of 266.26 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)-3H-quinazolin-4-one.
| Compound Name | 6-(1,3-benzodioxol-5-yl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135858724 |
| Molecular Formula | C15H10N2O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)-3H-quinazolin-4-one |
| SMILES | O=c1[nH]cnc2ccc(-c3ccc4c(c3)OCO4)cc12 |
| InChI | InChI=1S/C15H10N2O3/c18-15-11-5-9(1-3-12(11)16-7-17-15)10-2-4-13-14(6-10)20-8-19-13/h1-7H,8H2,(H,16,17,18) |
| InChIKey | TUSLADQZVAPPKX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |