C12H8N4O2 — CID 119064876
6-(1,3-benzodioxol-5-yl)-7H-purine (PubChem CID 119064876) has the molecular formula C12H8N4O2 and a molecular weight of 240.22 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)-7H-purine.
| Compound Name | 6-(1,3-benzodioxol-5-yl)-7H-purine |
|---|---|
| PubChem CID | 119064876 |
| Molecular Formula | C12H8N4O2 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)-7H-purine |
| SMILES | c1nc(-c2ccc3c(c2)OCO3)c2[nH]cnc2n1 |
| InChI | InChI=1S/C12H8N4O2/c1-2-8-9(18-6-17-8)3-7(1)10-11-12(15-4-13-10)16-5-14-11/h1-5H,6H2,(H,13,14,15,16) |
| InChIKey | YOXLBKDMTFGWQS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |