C21H12N12 — CID 15527163
6-[2,5-bis(7H-purin-6-yl)phenyl]-7H-purine (PubChem CID 15527163) has the molecular formula C21H12N12 and a molecular weight of 432.41 g/mol. Its IUPAC name is 6-[2,5-bis(7H-purin-6-yl)phenyl]-7H-purine.
| Compound Name | 6-[2,5-bis(7H-purin-6-yl)phenyl]-7H-purine |
|---|---|
| PubChem CID | 15527163 |
| Molecular Formula | C21H12N12 |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 6-[2,5-bis(7H-purin-6-yl)phenyl]-7H-purine |
| SMILES | c1nc(-c2ccc(-c3ncnc4nc[nH]c34)c(-c3ncnc4nc[nH]c34)c2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C21H12N12/c1-2-11(14-17-20(29-5-23-14)32-8-26-17)12(15-18-21(30-6-24-15)33-9-27-18)3-10(1)13-16-19(28-4-22-13)31-7-25-16/h1-9H,(H,22,25,28,31)(H,23,26,29,32)(H,24,27,30,33) |
| InChIKey | OQLFENHEKBUUBQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 163.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |