C18H14FN5 — CID 175807717
3-fluoro-N-[[4-(7H-purin-6-yl)phenyl]methyl]aniline (PubChem CID 175807717) has the molecular formula C18H14FN5 and a molecular weight of 319.34 g/mol. Its IUPAC name is 3-fluoro-N-[[4-(7H-purin-6-yl)phenyl]methyl]aniline.
| Compound Name | 3-fluoro-N-[[4-(7H-purin-6-yl)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 175807717 |
| Molecular Formula | C18H14FN5 |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 3-fluoro-N-[[4-(7H-purin-6-yl)phenyl]methyl]aniline |
| SMILES | Fc1cccc(NCc2ccc(-c3ncnc4nc[nH]c34)cc2)c1 |
| InChI | InChI=1S/C18H14FN5/c19-14-2-1-3-15(8-14)20-9-12-4-6-13(7-5-12)16-17-18(23-10-21-16)24-11-22-17/h1-8,10-11,20H,9H2,(H,21,22,23,24) |
| InChIKey | KVBIFNVRNXASAK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |