C18H23FN6 — CID 143922892
ethane;3-fluoro-N-[[1-(7H-purin-6-yl)pyrrolidin-2-yl]methyl]aniline (PubChem CID 143922892) has the molecular formula C18H23FN6 and a molecular weight of 342.42 g/mol. Its IUPAC name is ethane;3-fluoro-N-[[1-(7H-purin-6-yl)pyrrolidin-2-yl]methyl]aniline.
| Compound Name | ethane;3-fluoro-N-[[1-(7H-purin-6-yl)pyrrolidin-2-yl]methyl]aniline |
|---|---|
| PubChem CID | 143922892 |
| Molecular Formula | C18H23FN6 |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | ethane;3-fluoro-N-[[1-(7H-purin-6-yl)pyrrolidin-2-yl]methyl]aniline |
| SMILES | CC.Fc1cccc(NCC2CCCN2c2ncnc3nc[nH]c23)c1 |
| InChI | InChI=1S/C16H17FN6.C2H6/c17-11-3-1-4-12(7-11)18-8-13-5-2-6-23(13)16-14-15(20-9-19-14)21-10-22-16;1-2/h1,3-4,7,9-10,13,18H,2,5-6,8H2,(H,19,20,21,22);1-2H3 |
| InChIKey | KYPFIYAQWSHTCO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |