C15H15FN6O — CID 51102003
2-(3-fluorophenyl)-N-[2-(7H-purin-6-ylamino)ethyl]acetamide (PubChem CID 51102003) has the molecular formula C15H15FN6O and a molecular weight of 314.32 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-N-[2-(7H-purin-6-ylamino)ethyl]acetamide.
| Compound Name | 2-(3-fluorophenyl)-N-[2-(7H-purin-6-ylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 51102003 |
| Molecular Formula | C15H15FN6O |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 2-(3-fluorophenyl)-N-[2-(7H-purin-6-ylamino)ethyl]acetamide |
| SMILES | O=C(Cc1cccc(F)c1)NCCNc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C15H15FN6O/c16-11-3-1-2-10(6-11)7-12(23)17-4-5-18-14-13-15(20-8-19-13)22-9-21-14/h1-3,6,8-9H,4-5,7H2,(H,17,23)(H2,18,19,20,21,22) |
| InChIKey | GDOVQJHXWYOYQU-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|