C18H18FN7O — CID 42507459
N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-3-(7H-purin-6-ylamino)propanamide (PubChem CID 42507459) has the molecular formula C18H18FN7O and a molecular weight of 367.39 g/mol. Its IUPAC name is N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-3-(7H-purin-6-ylamino)propanamide.
| Compound Name | N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-3-(7H-purin-6-ylamino)propanamide |
|---|---|
| PubChem CID | 42507459 |
| Molecular Formula | C18H18FN7O |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-3-(7H-purin-6-ylamino)propanamide |
| SMILES | O=C(CCNc1ncnc2nc[nH]c12)NCCc1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C18H18FN7O/c19-12-1-2-14-13(7-12)11(8-22-14)3-5-20-15(27)4-6-21-17-16-18(24-9-23-16)26-10-25-17/h1-2,7-10,22H,3-6H2,(H,20,27)(H2,21,23,24,25,26) |
| InChIKey | UCDVACVFNFMBPR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |