C10H7N3O3 — CID 140823667
3,6-dihydropyrimido[5,4-g][1,4]benzoxazine-4,7-dione (PubChem CID 140823667) has the molecular formula C10H7N3O3 and a molecular weight of 217.18 g/mol. Its IUPAC name is 3,6-dihydropyrimido[5,4-g][1,4]benzoxazine-4,7-dione.
| Compound Name | 3,6-dihydropyrimido[5,4-g][1,4]benzoxazine-4,7-dione |
|---|---|
| PubChem CID | 140823667 |
| Molecular Formula | C10H7N3O3 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | 3,6-dihydropyrimido[5,4-g][1,4]benzoxazine-4,7-dione |
| SMILES | O=C1COc2cc3nc[nH]c(=O)c3cc2N1 |
| InChI | InChI=1S/C10H7N3O3/c14-9-3-16-8-2-6-5(1-7(8)13-9)10(15)12-4-11-6/h1-2,4H,3H2,(H,13,14)(H,11,12,15) |
| InChIKey | CRUHDNAWFIVCMC-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |