C15H11N3O2S — CID 169416854
9-methyl-7-(1,3-thiazol-4-yl)-1H-pyrido[3,2-g][1,4]benzoxazin-2-one (PubChem CID 169416854) has the molecular formula C15H11N3O2S and a molecular weight of 297.34 g/mol. Its IUPAC name is 9-methyl-7-(1,3-thiazol-4-yl)-1H-pyrido[3,2-g][1,4]benzoxazin-2-one.
| Compound Name | 9-methyl-7-(1,3-thiazol-4-yl)-1H-pyrido[3,2-g][1,4]benzoxazin-2-one |
|---|---|
| PubChem CID | 169416854 |
| Molecular Formula | C15H11N3O2S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 9-methyl-7-(1,3-thiazol-4-yl)-1H-pyrido[3,2-g][1,4]benzoxazin-2-one |
| SMILES | Cc1cc(-c2cscn2)nc2cc3c(cc12)NC(=O)CO3 |
| InChI | InChI=1S/C15H11N3O2S/c1-8-2-11(13-6-21-7-16-13)17-10-4-14-12(3-9(8)10)18-15(19)5-20-14/h2-4,6-7H,5H2,1H3,(H,18,19) |
| InChIKey | MIZAGKLMEVLHBX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |