C8H5F2NO2 — CID 46930344
6,7-difluoro-4H-1,4-benzoxazin-3-one (PubChem CID 46930344) has the molecular formula C8H5F2NO2 and a molecular weight of 185.13 g/mol. Its IUPAC name is 6,7-difluoro-4H-1,4-benzoxazin-3-one.
| Compound Name | 6,7-difluoro-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 46930344 |
| Molecular Formula | C8H5F2NO2 |
| Molecular Weight | 185.13 g/mol |
| Exact Mass | 185.03 |
| IUPAC Name | 6,7-difluoro-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2cc(F)c(F)cc2N1 |
| InChI | InChI=1S/C8H5F2NO2/c9-4-1-6-7(2-5(4)10)13-3-8(12)11-6/h1-2H,3H2,(H,11,12) |
| InChIKey | WFAHKQSSFLPKGA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.13 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |