C10H6FNO2 — CID 22625617
6-ethynyl-7-fluoro-4H-1,4-benzoxazin-3-one (PubChem CID 22625617) has the molecular formula C10H6FNO2 and a molecular weight of 191.16 g/mol. Its IUPAC name is 6-ethynyl-7-fluoro-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-ethynyl-7-fluoro-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 22625617 |
| Molecular Formula | C10H6FNO2 |
| Molecular Weight | 191.16 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | 6-ethynyl-7-fluoro-4H-1,4-benzoxazin-3-one |
| SMILES | C#Cc1cc2c(cc1F)OCC(=O)N2 |
| InChI | InChI=1S/C10H6FNO2/c1-2-6-3-8-9(4-7(6)11)14-5-10(13)12-8/h1,3-4H,5H2,(H,12,13) |
| InChIKey | OVVDNNVHPXPBMB-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.16 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|