C8H5BrFNO4S — CID 165459079
7-bromo-3-oxo-4H-1,4-benzoxazine-6-sulfonyl fluoride (PubChem CID 165459079) has the molecular formula C8H5BrFNO4S and a molecular weight of 310.10 g/mol. Its IUPAC name is 7-bromo-3-oxo-4H-1,4-benzoxazine-6-sulfonyl fluoride.
| Compound Name | 7-bromo-3-oxo-4H-1,4-benzoxazine-6-sulfonyl fluoride |
|---|---|
| PubChem CID | 165459079 |
| Molecular Formula | C8H5BrFNO4S |
| Molecular Weight | 310.10 g/mol |
| Exact Mass | 308.91 |
| IUPAC Name | 7-bromo-3-oxo-4H-1,4-benzoxazine-6-sulfonyl fluoride |
| SMILES | O=C1COc2cc(Br)c(S(=O)(=O)F)cc2N1 |
| InChI | InChI=1S/C8H5BrFNO4S/c9-4-1-6-5(11-8(12)3-15-6)2-7(4)16(10,13)14/h1-2H,3H2,(H,11,12) |
| InChIKey | WRCZDLBOZVZREW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.10 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |