C12H17BrClN3O4S — CID 120583337
N-(4-aminobutyl)-6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonamide;hydrochloride (PubChem CID 120583337) has the molecular formula C12H17BrClN3O4S and a molecular weight of 414.71 g/mol. Its IUPAC name is N-(4-aminobutyl)-6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonamide;hydrochloride.
| Compound Name | N-(4-aminobutyl)-6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120583337 |
| Molecular Formula | C12H17BrClN3O4S |
| Molecular Weight | 414.71 g/mol |
| Exact Mass | 412.98 |
| IUPAC Name | N-(4-aminobutyl)-6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonamide;hydrochloride |
| SMILES | Cl.NCCCCNS(=O)(=O)c1cc2c(cc1Br)NC(=O)CO2 |
| InChI | InChI=1S/C12H16BrN3O4S.ClH/c13-8-5-9-10(20-7-12(17)16-9)6-11(8)21(18,19)15-4-2-1-3-14;/h5-6,15H,1-4,7,14H2,(H,16,17);1H |
| InChIKey | ZHCRNTVBWKRITI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.71 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|