C8H5BrClNO4S — CID 42956278
6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonyl chloride (PubChem CID 42956278) has the molecular formula C8H5BrClNO4S and a molecular weight of 326.56 g/mol. Its IUPAC name is 6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonyl chloride.
| Compound Name | 6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonyl chloride |
|---|---|
| PubChem CID | 42956278 |
| Molecular Formula | C8H5BrClNO4S |
| Molecular Weight | 326.56 g/mol |
| Exact Mass | 324.88 |
| IUPAC Name | 6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonyl chloride |
| SMILES | O=C1COc2cc(S(=O)(=O)Cl)c(Br)cc2N1 |
| InChI | InChI=1S/C8H5BrClNO4S/c9-4-1-5-6(15-3-8(12)11-5)2-7(4)16(10,13)14/h1-2H,3H2,(H,11,12) |
| InChIKey | VZLLYSXSXMBKQS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.56 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |