6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonyl chloride

C8H5BrClNO4S — CID 42956278

IUPAC6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonyl chloride
SMILESO=C1COc2cc(S(=O)(=O)Cl)c(Br)cc2N1
InChIInChI=1S/C8H5BrClNO4S/c9-4-1-5-6(15-3-8(12)11-5)2-7(4)16(10,13)14/h1-2H,3H2,(H,11,12)
InChIKeyVZLLYSXSXMBKQS-UHFFFAOYSA-N
MW326.56 g/mol
LogP1.71
Rot. Bonds1

About 6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonyl chloride

6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonyl chloride (PubChem CID 42956278) has the molecular formula C8H5BrClNO4S and a molecular weight of 326.56 g/mol. Its IUPAC name is 6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonyl chloride.

Molecular Properties

Compound Name6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonyl chloride
PubChem CID42956278
Molecular FormulaC8H5BrClNO4S
Molecular Weight326.56 g/mol
Exact Mass324.88
IUPAC Name6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonyl chloride
SMILESO=C1COc2cc(S(=O)(=O)Cl)c(Br)cc2N1
InChIInChI=1S/C8H5BrClNO4S/c9-4-1-5-6(15-3-8(12)11-5)2-7(4)16(10,13)14/h1-2H,3H2,(H,11,12)
InChIKeyVZLLYSXSXMBKQS-UHFFFAOYSA-N
XLogP1.71
TPSA72.47 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500326.56
LogP ≤ 51.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonyl chloride?
The IUPAC name of 6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonyl chloride (CID 42956278) is 6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonyl chloride.
What is the SMILES notation for 6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonyl chloride?
The canonical SMILES for 6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonyl chloride is O=C1COc2cc(S(=O)(=O)Cl)c(Br)cc2N1.
What is the InChIKey of 6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonyl chloride?
The InChIKey is VZLLYSXSXMBKQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrClNO4S/c9-4-1-5-6(15-3-8(12)11-5)2-7(4)16(10,13)14/h1-2H,3H2,(H,11,12).
What are the key properties of 6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonyl chloride?
6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonyl chloride has a molecular weight of 326.56 g/mol, XLogP of 1.71, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonyl chloride is sourced from PubChem (CID 42956278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).