C8H6BrNO2S — CID 43152991
6-bromo-7-sulfanyl-4H-1,4-benzoxazin-3-one (PubChem CID 43152991) has the molecular formula C8H6BrNO2S and a molecular weight of 260.11 g/mol. Its IUPAC name is 6-bromo-7-sulfanyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-bromo-7-sulfanyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 43152991 |
| Molecular Formula | C8H6BrNO2S |
| Molecular Weight | 260.11 g/mol |
| Exact Mass | 258.93 |
| IUPAC Name | 6-bromo-7-sulfanyl-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2cc(S)c(Br)cc2N1 |
| InChI | InChI=1S/C8H6BrNO2S/c9-4-1-5-6(2-7(4)13)12-3-8(11)10-5/h1-2,13H,3H2,(H,10,11) |
| InChIKey | HGOOUVFEJOMPTH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.11 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|