C14H17BrN2O3S — CID 163372202
6-bromo-7-[(4-hydroxycyclohexyl)amino]sulfanyl-4H-1,4-benzoxazin-3-one (PubChem CID 163372202) has the molecular formula C14H17BrN2O3S and a molecular weight of 373.27 g/mol. Its IUPAC name is 6-bromo-7-[(4-hydroxycyclohexyl)amino]sulfanyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-bromo-7-[(4-hydroxycyclohexyl)amino]sulfanyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 163372202 |
| Molecular Formula | C14H17BrN2O3S |
| Molecular Weight | 373.27 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 6-bromo-7-[(4-hydroxycyclohexyl)amino]sulfanyl-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2cc(SNC3CCC(O)CC3)c(Br)cc2N1 |
| InChI | InChI=1S/C14H17BrN2O3S/c15-10-5-11-12(20-7-14(19)16-11)6-13(10)21-17-8-1-3-9(18)4-2-8/h5-6,8-9,17-18H,1-4,7H2,(H,16,19) |
| InChIKey | LOKYZNDLVJZQRS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|