C13H6BrCl2NO3S — CID 107959929
6-bromo-7-(2,5-dichlorothiophene-3-carbonyl)-4H-1,4-benzoxazin-3-one (PubChem CID 107959929) has the molecular formula C13H6BrCl2NO3S and a molecular weight of 407.07 g/mol. Its IUPAC name is 6-bromo-7-(2,5-dichlorothiophene-3-carbonyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-bromo-7-(2,5-dichlorothiophene-3-carbonyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 107959929 |
| Molecular Formula | C13H6BrCl2NO3S |
| Molecular Weight | 407.07 g/mol |
| Exact Mass | 404.86 |
| IUPAC Name | 6-bromo-7-(2,5-dichlorothiophene-3-carbonyl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2cc(C(=O)c3cc(Cl)sc3Cl)c(Br)cc2N1 |
| InChI | InChI=1S/C13H6BrCl2NO3S/c14-7-3-8-9(20-4-11(18)17-8)1-5(7)12(19)6-2-10(15)21-13(6)16/h1-3H,4H2,(H,17,18) |
| InChIKey | JKFKJHQIZSIECF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.07 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |