C13H7BrClNO3S — CID 62276102
6-bromo-7-(5-chlorothiophene-2-carbonyl)-4H-1,4-benzoxazin-3-one (PubChem CID 62276102) has the molecular formula C13H7BrClNO3S and a molecular weight of 372.63 g/mol. Its IUPAC name is 6-bromo-7-(5-chlorothiophene-2-carbonyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-bromo-7-(5-chlorothiophene-2-carbonyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 62276102 |
| Molecular Formula | C13H7BrClNO3S |
| Molecular Weight | 372.63 g/mol |
| Exact Mass | 370.90 |
| IUPAC Name | 6-bromo-7-(5-chlorothiophene-2-carbonyl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2cc(C(=O)c3ccc(Cl)s3)c(Br)cc2N1 |
| InChI | InChI=1S/C13H7BrClNO3S/c14-7-4-8-9(19-5-12(17)16-8)3-6(7)13(18)10-1-2-11(15)20-10/h1-4H,5H2,(H,16,17) |
| InChIKey | LESQUMFWTTUTHA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.63 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |