C15H21BrN2O4S — CID 42958027
6-bromo-N-heptan-2-yl-3-oxo-4H-1,4-benzoxazine-7-sulfonamide (PubChem CID 42958027) has the molecular formula C15H21BrN2O4S and a molecular weight of 405.31 g/mol. Its IUPAC name is 6-bromo-N-heptan-2-yl-3-oxo-4H-1,4-benzoxazine-7-sulfonamide.
| Compound Name | 6-bromo-N-heptan-2-yl-3-oxo-4H-1,4-benzoxazine-7-sulfonamide |
|---|---|
| PubChem CID | 42958027 |
| Molecular Formula | C15H21BrN2O4S |
| Molecular Weight | 405.31 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | 6-bromo-N-heptan-2-yl-3-oxo-4H-1,4-benzoxazine-7-sulfonamide |
| SMILES | CCCCCC(C)NS(=O)(=O)c1cc2c(cc1Br)NC(=O)CO2 |
| InChI | InChI=1S/C15H21BrN2O4S/c1-3-4-5-6-10(2)18-23(20,21)14-8-13-12(7-11(14)16)17-15(19)9-22-13/h7-8,10,18H,3-6,9H2,1-2H3,(H,17,19) |
| InChIKey | UUMNDOJWCIVASC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|