C15H13N3O4S — CID 110869241
N-(3H-benzimidazol-5-yl)-N-methyl-1,3-benzodioxole-5-sulfonamide (PubChem CID 110869241) has the molecular formula C15H13N3O4S and a molecular weight of 331.35 g/mol. Its IUPAC name is N-(3H-benzimidazol-5-yl)-N-methyl-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-(3H-benzimidazol-5-yl)-N-methyl-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 110869241 |
| Molecular Formula | C15H13N3O4S |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-(3H-benzimidazol-5-yl)-N-methyl-1,3-benzodioxole-5-sulfonamide |
| SMILES | CN(c1ccc2nc[nH]c2c1)S(=O)(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H13N3O4S/c1-18(10-2-4-12-13(6-10)17-8-16-12)23(19,20)11-3-5-14-15(7-11)22-9-21-14/h2-8H,9H2,1H3,(H,16,17) |
| InChIKey | BNDYYEXHCOJBCM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |