About 3-(1,3-benzodioxol-5-yl)-4,7-phenanthroline
3-(1,3-benzodioxol-5-yl)-4,7-phenanthroline (PubChem CID 71482313) has the molecular formula C19H12N2O2
and a molecular weight of 300.32 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-4,7-phenanthroline.
Molecular Properties
| Compound Name | 3-(1,3-benzodioxol-5-yl)-4,7-phenanthroline |
| PubChem CID | 71482313 |
| Molecular Formula | C19H12N2O2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-4,7-phenanthroline |
| SMILES | c1cnc2ccc3nc(-c4ccc5c(c4)OCO5)ccc3c2c1 |
| InChI | InChI=1S/C19H12N2O2/c1-2-13-14-4-5-15(21-17(14)7-6-16(13)20-9-1)12-3-8-18-19(10-12)23-11-22-18/h1-10H,11H2 |
| InChIKey | JYJCCIDNSUERDI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,3-benzodioxol-5-yl)-4,7-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-benzodioxol-5-yl)-4,7-phenanthroline?
The IUPAC name of 3-(1,3-benzodioxol-5-yl)-4,7-phenanthroline (CID 71482313) is 3-(1,3-benzodioxol-5-yl)-4,7-phenanthroline.
What is the SMILES notation for 3-(1,3-benzodioxol-5-yl)-4,7-phenanthroline?
The canonical SMILES for 3-(1,3-benzodioxol-5-yl)-4,7-phenanthroline is c1cnc2ccc3nc(-c4ccc5c(c4)OCO5)ccc3c2c1.
What is the InChIKey of 3-(1,3-benzodioxol-5-yl)-4,7-phenanthroline?
The InChIKey is JYJCCIDNSUERDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12N2O2/c1-2-13-14-4-5-15(21-17(14)7-6-16(13)20-9-1)12-3-8-18-19(10-12)23-11-22-18/h1-10H,11H2.
What are the key properties of 3-(1,3-benzodioxol-5-yl)-4,7-phenanthroline?
3-(1,3-benzodioxol-5-yl)-4,7-phenanthroline has a molecular weight of 300.32 g/mol, XLogP of 4.18, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzodioxol-5-yl)-4,7-phenanthroline is sourced from PubChem (CID 71482313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).