C20H17N3O2 — CID 157257379
2-(1,3-benzodioxol-5-yl)-6-imidazol-1-ylquinoline;methane (PubChem CID 157257379) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-6-imidazol-1-ylquinoline;methane.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-6-imidazol-1-ylquinoline;methane |
|---|---|
| PubChem CID | 157257379 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-6-imidazol-1-ylquinoline;methane |
| SMILES | C.c1cn(-c2ccc3nc(-c4ccc5c(c4)OCO5)ccc3c2)cn1 |
| InChI | InChI=1S/C19H13N3O2.CH4/c1-4-16(14-2-6-18-19(10-14)24-12-23-18)21-17-5-3-15(9-13(1)17)22-8-7-20-11-22;/h1-11H,12H2;1H4 |
| InChIKey | AXAWSFJQWQWFDI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |