C14H10N4O2 — CID 3234102
2-(1,3-benzodioxol-5-yl)-4-imidazol-1-ylpyrimidine (PubChem CID 3234102) has the molecular formula C14H10N4O2 and a molecular weight of 266.26 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-4-imidazol-1-ylpyrimidine.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-4-imidazol-1-ylpyrimidine |
|---|---|
| PubChem CID | 3234102 |
| Molecular Formula | C14H10N4O2 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-4-imidazol-1-ylpyrimidine |
| SMILES | c1cn(-c2ccnc(-c3ccc4c(c3)OCO4)n2)cn1 |
| InChI | InChI=1S/C14H10N4O2/c1-2-11-12(20-9-19-11)7-10(1)14-16-4-3-13(17-14)18-6-5-15-8-18/h1-8H,9H2 |
| InChIKey | PAGHDYFEFCGWHW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |