C16H17N3O3 — CID 77088330
1-[2-(1,3-benzodioxol-5-yl)pyrimidin-4-yl]piperidin-3-ol (PubChem CID 77088330) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)pyrimidin-4-yl]piperidin-3-ol.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)pyrimidin-4-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 77088330 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)pyrimidin-4-yl]piperidin-3-ol |
| SMILES | OC1CCCN(c2ccnc(-c3ccc4c(c3)OCO4)n2)C1 |
| InChI | InChI=1S/C16H17N3O3/c20-12-2-1-7-19(9-12)15-5-6-17-16(18-15)11-3-4-13-14(8-11)22-10-21-13/h3-6,8,12,20H,1-2,7,9-10H2 |
| InChIKey | WOMOGWIDJMTCCR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |