C17H16N4O — CID 74243840
1-(2-quinolin-3-ylpyrimidin-4-yl)pyrrolidin-3-ol (PubChem CID 74243840) has the molecular formula C17H16N4O and a molecular weight of 292.34 g/mol. Its IUPAC name is 1-(2-quinolin-3-ylpyrimidin-4-yl)pyrrolidin-3-ol.
| Compound Name | 1-(2-quinolin-3-ylpyrimidin-4-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 74243840 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 1-(2-quinolin-3-ylpyrimidin-4-yl)pyrrolidin-3-ol |
| SMILES | OC1CCN(c2ccnc(-c3cnc4ccccc4c3)n2)C1 |
| InChI | InChI=1S/C17H16N4O/c22-14-6-8-21(11-14)16-5-7-18-17(20-16)13-9-12-3-1-2-4-15(12)19-10-13/h1-5,7,9-10,14,22H,6,8,11H2 |
| InChIKey | AZYYWPJTAITMOJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |