C16H16F3N3O2 — CID 99928309
(3R)-1-[2-[3-(trifluoromethoxy)phenyl]pyrimidin-4-yl]piperidin-3-ol (PubChem CID 99928309) has the molecular formula C16H16F3N3O2 and a molecular weight of 339.32 g/mol. Its IUPAC name is (3R)-1-[2-[3-(trifluoromethoxy)phenyl]pyrimidin-4-yl]piperidin-3-ol.
| Compound Name | (3R)-1-[2-[3-(trifluoromethoxy)phenyl]pyrimidin-4-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 99928309 |
| Molecular Formula | C16H16F3N3O2 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | (3R)-1-[2-[3-(trifluoromethoxy)phenyl]pyrimidin-4-yl]piperidin-3-ol |
| SMILES | O[C@@H]1CCCN(c2ccnc(-c3cccc(OC(F)(F)F)c3)n2)C1 |
| InChI | InChI=1S/C16H16F3N3O2/c17-16(18,19)24-13-5-1-3-11(9-13)15-20-7-6-14(21-15)22-8-2-4-12(23)10-22/h1,3,5-7,9,12,23H,2,4,8,10H2/t12-/m1/s1 |
| InChIKey | OLJKYQILMNYZAS-GFCCVEGCSA-N |
| XLogP | 3.00 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |