C12H14F3NO2 — CID 58973484
1-[3-(trifluoromethoxy)phenyl]piperidin-3-ol (PubChem CID 58973484) has the molecular formula C12H14F3NO2 and a molecular weight of 261.24 g/mol. Its IUPAC name is 1-[3-(trifluoromethoxy)phenyl]piperidin-3-ol.
| Compound Name | 1-[3-(trifluoromethoxy)phenyl]piperidin-3-ol |
|---|---|
| PubChem CID | 58973484 |
| Molecular Formula | C12H14F3NO2 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 1-[3-(trifluoromethoxy)phenyl]piperidin-3-ol |
| SMILES | OC1CCCN(c2cccc(OC(F)(F)F)c2)C1 |
| InChI | InChI=1S/C12H14F3NO2/c13-12(14,15)18-11-5-1-3-9(7-11)16-6-2-4-10(17)8-16/h1,3,5,7,10,17H,2,4,6,8H2 |
| InChIKey | VHGFPRKHIHBQDN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |