C15H14F3N3O — CID 74234331
1-[2-[2-(trifluoromethyl)phenyl]pyrimidin-4-yl]pyrrolidin-3-ol (PubChem CID 74234331) has the molecular formula C15H14F3N3O and a molecular weight of 309.29 g/mol. Its IUPAC name is 1-[2-[2-(trifluoromethyl)phenyl]pyrimidin-4-yl]pyrrolidin-3-ol.
| Compound Name | 1-[2-[2-(trifluoromethyl)phenyl]pyrimidin-4-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 74234331 |
| Molecular Formula | C15H14F3N3O |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 1-[2-[2-(trifluoromethyl)phenyl]pyrimidin-4-yl]pyrrolidin-3-ol |
| SMILES | OC1CCN(c2ccnc(-c3ccccc3C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C15H14F3N3O/c16-15(17,18)12-4-2-1-3-11(12)14-19-7-5-13(20-14)21-8-6-10(22)9-21/h1-5,7,10,22H,6,8-9H2 |
| InChIKey | AIQNIRDKTUNKBV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |