C16H15F4N3O — CID 99930102
(3R)-1-[2-[4-fluoro-3-(trifluoromethyl)phenyl]pyrimidin-4-yl]piperidin-3-ol (PubChem CID 99930102) has the molecular formula C16H15F4N3O and a molecular weight of 341.31 g/mol. Its IUPAC name is (3R)-1-[2-[4-fluoro-3-(trifluoromethyl)phenyl]pyrimidin-4-yl]piperidin-3-ol.
| Compound Name | (3R)-1-[2-[4-fluoro-3-(trifluoromethyl)phenyl]pyrimidin-4-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 99930102 |
| Molecular Formula | C16H15F4N3O |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | (3R)-1-[2-[4-fluoro-3-(trifluoromethyl)phenyl]pyrimidin-4-yl]piperidin-3-ol |
| SMILES | O[C@@H]1CCCN(c2ccnc(-c3ccc(F)c(C(F)(F)F)c3)n2)C1 |
| InChI | InChI=1S/C16H15F4N3O/c17-13-4-3-10(8-12(13)16(18,19)20)15-21-6-5-14(22-15)23-7-1-2-11(24)9-23/h3-6,8,11,24H,1-2,7,9H2/t11-/m1/s1 |
| InChIKey | CPAFGWUFDZYKKC-LLVKDONJSA-N |
| XLogP | 3.26 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |