C15H15N3O3 — CID 56770770
1-[6-(1,3-benzodioxol-5-yl)pyridazin-3-yl]pyrrolidin-3-ol (PubChem CID 56770770) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 1-[6-(1,3-benzodioxol-5-yl)pyridazin-3-yl]pyrrolidin-3-ol.
| Compound Name | 1-[6-(1,3-benzodioxol-5-yl)pyridazin-3-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 56770770 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 1-[6-(1,3-benzodioxol-5-yl)pyridazin-3-yl]pyrrolidin-3-ol |
| SMILES | OC1CCN(c2ccc(-c3ccc4c(c3)OCO4)nn2)C1 |
| InChI | InChI=1S/C15H15N3O3/c19-11-5-6-18(8-11)15-4-2-12(16-17-15)10-1-3-13-14(7-10)21-9-20-13/h1-4,7,11,19H,5-6,8-9H2 |
| InChIKey | UAFGTQZRUJVQCA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |