C17H19Br2N3O2 — CID 160598444
N-(3,5-dibromo-4-methylphenyl)-6,7-dimethylquinazolin-4-amine;dihydrate (PubChem CID 160598444) has the molecular formula C17H19Br2N3O2 and a molecular weight of 457.17 g/mol. Its IUPAC name is N-(3,5-dibromo-4-methylphenyl)-6,7-dimethylquinazolin-4-amine;dihydrate.
| Compound Name | N-(3,5-dibromo-4-methylphenyl)-6,7-dimethylquinazolin-4-amine;dihydrate |
|---|---|
| PubChem CID | 160598444 |
| Molecular Formula | C17H19Br2N3O2 |
| Molecular Weight | 457.17 g/mol |
| Exact Mass | 454.98 |
| IUPAC Name | N-(3,5-dibromo-4-methylphenyl)-6,7-dimethylquinazolin-4-amine;dihydrate |
| SMILES | Cc1cc2ncnc(Nc3cc(Br)c(C)c(Br)c3)c2cc1C.O.O |
| InChI | InChI=1S/C17H15Br2N3.2H2O/c1-9-4-13-16(5-10(9)2)20-8-21-17(13)22-12-6-14(18)11(3)15(19)7-12;;/h4-8H,1-3H3,(H,20,21,22);2*1H2 |
| InChIKey | MJBICWLFMBLRLA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.17 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |