C18H17F6N3O2 — CID 159537873
N-[3,5-bis(trifluoromethyl)phenyl]-6,7-dimethylquinazolin-4-amine;dihydrate (PubChem CID 159537873) has the molecular formula C18H17F6N3O2 and a molecular weight of 421.34 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-6,7-dimethylquinazolin-4-amine;dihydrate.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-6,7-dimethylquinazolin-4-amine;dihydrate |
|---|---|
| PubChem CID | 159537873 |
| Molecular Formula | C18H17F6N3O2 |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-6,7-dimethylquinazolin-4-amine;dihydrate |
| SMILES | Cc1cc2ncnc(Nc3cc(C(F)(F)F)cc(C(F)(F)F)c3)c2cc1C.O.O |
| InChI | InChI=1S/C18H13F6N3.2H2O/c1-9-3-14-15(4-10(9)2)25-8-26-16(14)27-13-6-11(17(19,20)21)5-12(7-13)18(22,23)24;;/h3-8H,1-2H3,(H,25,26,27);2*1H2 |
| InChIKey | WOUBDRBNAZCSEO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |