C22H16F3N3O — CID 155924465
7-methyl-N-[4-[4-(trifluoromethyl)phenoxy]phenyl]quinazolin-4-amine (PubChem CID 155924465) has the molecular formula C22H16F3N3O and a molecular weight of 395.38 g/mol. Its IUPAC name is 7-methyl-N-[4-[4-(trifluoromethyl)phenoxy]phenyl]quinazolin-4-amine.
| Compound Name | 7-methyl-N-[4-[4-(trifluoromethyl)phenoxy]phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 155924465 |
| Molecular Formula | C22H16F3N3O |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 7-methyl-N-[4-[4-(trifluoromethyl)phenoxy]phenyl]quinazolin-4-amine |
| SMILES | Cc1ccc2c(Nc3ccc(Oc4ccc(C(F)(F)F)cc4)cc3)ncnc2c1 |
| InChI | InChI=1S/C22H16F3N3O/c1-14-2-11-19-20(12-14)26-13-27-21(19)28-16-5-9-18(10-6-16)29-17-7-3-15(4-8-17)22(23,24)25/h2-13H,1H3,(H,26,27,28) |
| InChIKey | DNOZTGJGEDJKHK-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |