C16H10F3N3O2 — CID 126745164
4-[4-(trifluoromethoxy)anilino]quinazoline-7-carbaldehyde (PubChem CID 126745164) has the molecular formula C16H10F3N3O2 and a molecular weight of 333.27 g/mol. Its IUPAC name is 4-[4-(trifluoromethoxy)anilino]quinazoline-7-carbaldehyde.
| Compound Name | 4-[4-(trifluoromethoxy)anilino]quinazoline-7-carbaldehyde |
|---|---|
| PubChem CID | 126745164 |
| Molecular Formula | C16H10F3N3O2 |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 4-[4-(trifluoromethoxy)anilino]quinazoline-7-carbaldehyde |
| SMILES | O=Cc1ccc2c(Nc3ccc(OC(F)(F)F)cc3)ncnc2c1 |
| InChI | InChI=1S/C16H10F3N3O2/c17-16(18,19)24-12-4-2-11(3-5-12)22-15-13-6-1-10(8-23)7-14(13)20-9-21-15/h1-9H,(H,20,21,22) |
| InChIKey | DAOLNUNJXUMZFQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|