C20H17F3N4O3 — CID 68627621
(3-hydroxypyrrolidin-1-yl)-[4-[4-(trifluoromethoxy)anilino]quinazolin-7-yl]methanone (PubChem CID 68627621) has the molecular formula C20H17F3N4O3 and a molecular weight of 418.38 g/mol. Its IUPAC name is (3-hydroxypyrrolidin-1-yl)-[4-[4-(trifluoromethoxy)anilino]quinazolin-7-yl]methanone.
| Compound Name | (3-hydroxypyrrolidin-1-yl)-[4-[4-(trifluoromethoxy)anilino]quinazolin-7-yl]methanone |
|---|---|
| PubChem CID | 68627621 |
| Molecular Formula | C20H17F3N4O3 |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | (3-hydroxypyrrolidin-1-yl)-[4-[4-(trifluoromethoxy)anilino]quinazolin-7-yl]methanone |
| SMILES | O=C(c1ccc2c(Nc3ccc(OC(F)(F)F)cc3)ncnc2c1)N1CCC(O)C1 |
| InChI | InChI=1S/C20H17F3N4O3/c21-20(22,23)30-15-4-2-13(3-5-15)26-18-16-6-1-12(9-17(16)24-11-25-18)19(29)27-8-7-14(28)10-27/h1-6,9,11,14,28H,7-8,10H2,(H,24,25,26) |
| InChIKey | CHBZTCMXSHRBNJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |