C24H23F3N4O4 — CID 68628228
ethyl 1-[4-[4-(trifluoromethoxy)anilino]quinazoline-7-carbonyl]piperidine-3-carboxylate (PubChem CID 68628228) has the molecular formula C24H23F3N4O4 and a molecular weight of 488.47 g/mol. Its IUPAC name is ethyl 1-[4-[4-(trifluoromethoxy)anilino]quinazoline-7-carbonyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[4-[4-(trifluoromethoxy)anilino]quinazoline-7-carbonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 68628228 |
| Molecular Formula | C24H23F3N4O4 |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | ethyl 1-[4-[4-(trifluoromethoxy)anilino]quinazoline-7-carbonyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)c2ccc3c(Nc4ccc(OC(F)(F)F)cc4)ncnc3c2)C1 |
| InChI | InChI=1S/C24H23F3N4O4/c1-2-34-23(33)16-4-3-11-31(13-16)22(32)15-5-10-19-20(12-15)28-14-29-21(19)30-17-6-8-18(9-7-17)35-24(25,26)27/h5-10,12,14,16H,2-4,11,13H2,1H3,(H,28,29,30) |
| InChIKey | RBLUGQGHRAOFAU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |