C17H22N4O3 — CID 31463500
ethyl (3R)-1-(1-ethylbenzotriazole-5-carbonyl)piperidine-3-carboxylate (PubChem CID 31463500) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is ethyl (3R)-1-(1-ethylbenzotriazole-5-carbonyl)piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-(1-ethylbenzotriazole-5-carbonyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 31463500 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | ethyl (3R)-1-(1-ethylbenzotriazole-5-carbonyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(C(=O)c2ccc3c(c2)nnn3CC)C1 |
| InChI | InChI=1S/C17H22N4O3/c1-3-21-15-8-7-12(10-14(15)18-19-21)16(22)20-9-5-6-13(11-20)17(23)24-4-2/h7-8,10,13H,3-6,9,11H2,1-2H3/t13-/m1/s1 |
| InChIKey | GLZDEHPMRFMVBZ-CYBMUJFWSA-N |
| XLogP | 1.87 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |